C19H19ClN2O4S — CID 25257695
[2-(4-aminophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone;hydrochloride (PubChem CID 25257695) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone;hydrochloride.
| Compound Name | [2-(4-aminophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 25257695 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-(4-aminophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone;hydrochloride |
| SMILES | COc1cc(C(=O)c2csc(-c3ccc(N)cc3)n2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C19H18N2O4S.ClH/c1-23-15-8-12(9-16(24-2)18(15)25-3)17(22)14-10-26-19(21-14)11-4-6-13(20)7-5-11;/h4-10H,20H2,1-3H3;1H |
| InChIKey | JJIFPPNXNWTBHV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|