C27H20BF2N3 — CID 25257968
4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-diphenylaniline (PubChem CID 25257968) has the molecular formula C27H20BF2N3 and a molecular weight of 435.29 g/mol. Its IUPAC name is 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-diphenylaniline.
| Compound Name | 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 25257968 |
| Molecular Formula | C27H20BF2N3 |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-diphenylaniline |
| SMILES | F[B-]1(F)n2cccc2C(c2ccc(N(c3ccccc3)c3ccccc3)cc2)=C2C=CC=[N+]21 |
| InChI | InChI=1S/C27H20BF2N3/c29-28(30)31-19-7-13-25(31)27(26-14-8-20-32(26)28)21-15-17-24(18-16-21)33(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-20H |
| InChIKey | BIDKJNTUQCGLFY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 11.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|