About CID 25258305
CID 25258305 (PubChem CID 25258305) has the molecular formula C55H63FeNO4P2+2
and a molecular weight of 919.90 g/mol.
Molecular Properties
| Compound Name | CID 25258305 |
| PubChem CID | 25258305 |
| Molecular Formula | C55H63FeNO4P2+2 |
| Molecular Weight | 919.90 g/mol |
| Exact Mass | 919.36 |
| IUPAC Name | — |
| SMILES | COc1c(C)cc(P([C]2[CH][CH][CH][C]2[C@H](c2ccccc2P(c2cc(C)c(OC)c(C)c2)c2cc(C)c(OC)c(C)c2)N(C)C)c2cc(C)c(OC)c(C)c2)cc1C.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C50H58NO4P2.C5H5.Fe/c1-30-22-38(23-31(2)47(30)52-11)56(39-24-32(3)48(53-12)33(4)25-39)44-20-16-15-18-42(44)46(51(9)10)43-19-17-21-45(43)57(40-26-34(5)49(54-13)35(6)27-40)41-28-36(7)50(55-14)37(8)29-41;1-2-4-5-3-1;/h15-29,46H,1-14H3;1-5H;/q;;+2/t46-;;/m0../s1 |
| InChIKey | OLZBCQGEMIRUOH-RIFBMQLHSA-N |
| XLogP | 10.43 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 919.90 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 25258305 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25258305?
The IUPAC name of CID 25258305 (CID 25258305) is not available.
What is the SMILES notation for CID 25258305?
The canonical SMILES for CID 25258305 is COc1c(C)cc(P([C]2[CH][CH][CH][C]2[C@H](c2ccccc2P(c2cc(C)c(OC)c(C)c2)c2cc(C)c(OC)c(C)c2)N(C)C)c2cc(C)c(OC)c(C)c2)cc1C.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 25258305?
The InChIKey is OLZBCQGEMIRUOH-RIFBMQLHSA-N. The full InChI is InChI=1S/C50H58NO4P2.C5H5.Fe/c1-30-22-38(23-31(2)47(30)52-11)56(39-24-32(3)48(53-12)33(4)25-39)44-20-16-15-18-42(44)46(51(9)10)43-19-17-21-45(43)57(40-26-34(5)49(54-13)35(6)27-40)41-28-36(7)50(55-14)37(8)29-41;1-2-4-5-3-1;/h15-29,46H,1-14H3;1-5H;/q;;+2/t46-;;/m0../s1.
What are the key properties of CID 25258305?
CID 25258305 has a molecular weight of 919.90 g/mol, XLogP of 10.43, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25258305 is sourced from PubChem (CID 25258305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).