C29H33NO2 — CID 25258382
(2R,4aR,10aR)-4a-ethyl-7-[(2-methyl-3-pyridinyl)methoxy]-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 25258382) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is (2R,4aR,10aR)-4a-ethyl-7-[(2-methyl-3-pyridinyl)methoxy]-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2R,4aR,10aR)-4a-ethyl-7-[(2-methyl-3-pyridinyl)methoxy]-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 25258382 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (2R,4aR,10aR)-4a-ethyl-7-[(2-methyl-3-pyridinyl)methoxy]-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | CC[C@@]12CC[C@](O)(c3ccccc3)C[C@H]1CCc1cc(OCc3cccnc3C)ccc12 |
| InChI | InChI=1S/C29H33NO2/c1-3-28-15-16-29(31,24-9-5-4-6-10-24)19-25(28)12-11-22-18-26(13-14-27(22)28)32-20-23-8-7-17-30-21(23)2/h4-10,13-14,17-18,25,31H,3,11-12,15-16,19-20H2,1-2H3/t25-,28-,29-/m1/s1 |
| InChIKey | QAPGDQZHOLUJSE-MOZWKJSSSA-N |
| XLogP | 6.25 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |