C25H29NO2 — CID 25258611
(2R,4aR,10aR)-4a-ethyl-2-prop-1-ynyl-7-(pyridin-4-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 25258611) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (2R,4aR,10aR)-4a-ethyl-2-prop-1-ynyl-7-(pyridin-4-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2R,4aR,10aR)-4a-ethyl-2-prop-1-ynyl-7-(pyridin-4-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 25258611 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2R,4aR,10aR)-4a-ethyl-2-prop-1-ynyl-7-(pyridin-4-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | CC#C[C@@]1(O)CC[C@@]2(CC)c3ccc(OCc4ccncc4)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C25H29NO2/c1-3-11-24(27)12-13-25(4-2)21(17-24)6-5-20-16-22(7-8-23(20)25)28-18-19-9-14-26-15-10-19/h7-10,14-16,21,27H,4-6,12-13,17-18H2,1-2H3/t21-,24-,25-/m1/s1 |
| InChIKey | GUJAUKQZCIPIBV-NQHRYMMQSA-N |
| XLogP | 4.81 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|