C31H54O12Si2 — CID 25258662
[(1S,2S,3S,4S,6R,7R,8S)-2,3,4,8-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylidenecyclooctyl] acetate (PubChem CID 25258662) has the molecular formula C31H54O12Si2 and a molecular weight of 674.93 g/mol. Its IUPAC name is [(1S,2S,3S,4S,6R,7R,8S)-2,3,4,8-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylidenecyclooctyl] acetate.
| Compound Name | [(1S,2S,3S,4S,6R,7R,8S)-2,3,4,8-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylidenecyclooctyl] acetate |
|---|---|
| PubChem CID | 25258662 |
| Molecular Formula | C31H54O12Si2 |
| Molecular Weight | 674.93 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | [(1S,2S,3S,4S,6R,7R,8S)-2,3,4,8-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylidenecyclooctyl] acetate |
| SMILES | C=C1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H54O12Si2/c1-17-23(37-18(2)32)25(38-19(3)33)26(39-20(4)34)27(40-21(5)35)28(41-22(6)36)29(43-45(15,16)31(10,11)12)24(17)42-44(13,14)30(7,8)9/h23-29H,1H2,2-16H3/t23-,24+,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | JHNBWLWKZPNBSN-YKPAUJJQSA-N |
| XLogP | 5.00 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|