C19H16N2O6S — CID 25258831
[2-(4-nitrophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 25258831) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [2-(4-nitrophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 25258831 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | [2-(4-nitrophenyl)-1,3-thiazol-4-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2csc(-c3ccc([N+](=O)[O-])cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H16N2O6S/c1-25-15-8-12(9-16(26-2)18(15)27-3)17(22)14-10-28-19(20-14)11-4-6-13(7-5-11)21(23)24/h4-10H,1-3H3 |
| InChIKey | CRCDSSNETKMUKH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|