C20H16N2O4S — CID 25258832
4-[4-(3,4,5-trimethoxybenzoyl)-1,3-thiazol-2-yl]benzonitrile (PubChem CID 25258832) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[4-(3,4,5-trimethoxybenzoyl)-1,3-thiazol-2-yl]benzonitrile.
| Compound Name | 4-[4-(3,4,5-trimethoxybenzoyl)-1,3-thiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 25258832 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-[4-(3,4,5-trimethoxybenzoyl)-1,3-thiazol-2-yl]benzonitrile |
| SMILES | COc1cc(C(=O)c2csc(-c3ccc(C#N)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H16N2O4S/c1-24-16-8-14(9-17(25-2)19(16)26-3)18(23)15-11-27-20(22-15)13-6-4-12(10-21)5-7-13/h4-9,11H,1-3H3 |
| InChIKey | ZVEYCXZZSZYVNG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |