C16H20O — CID 25258871
(2R,3aR,5aS,9aS,10aR)-2-ethenyl-2,3,3a,5a,6,9,9a,10a-octahydro-1H-benzo[f]azulen-10-one (PubChem CID 25258871) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is (2R,3aR,5aS,9aS,10aR)-2-ethenyl-2,3,3a,5a,6,9,9a,10a-octahydro-1H-benzo[f]azulen-10-one.
| Compound Name | (2R,3aR,5aS,9aS,10aR)-2-ethenyl-2,3,3a,5a,6,9,9a,10a-octahydro-1H-benzo[f]azulen-10-one |
|---|---|
| PubChem CID | 25258871 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2R,3aR,5aS,9aS,10aR)-2-ethenyl-2,3,3a,5a,6,9,9a,10a-octahydro-1H-benzo[f]azulen-10-one |
| SMILES | C=C[C@@H]1C[C@@H]2C=C[C@@H]3CC=CC[C@@H]3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C16H20O/c1-2-11-9-13-8-7-12-5-3-4-6-14(12)16(17)15(13)10-11/h2-4,7-8,11-15H,1,5-6,9-10H2/t11-,12+,13+,14+,15-/m1/s1 |
| InChIKey | AALWLLCDYMXQIK-CAEXGNQWSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|