About lithium phenyl N,N-diethylcarbamate
lithium phenyl N,N-diethylcarbamate (PubChem CID 25258917) has the molecular formula C11H14LiNO2
and a molecular weight of 199.18 g/mol. Its IUPAC name is lithium phenyl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | lithium phenyl N,N-diethylcarbamate |
| PubChem CID | 25258917 |
| Molecular Formula | C11H14LiNO2 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | lithium phenyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1[c-]cccc1.[Li+] |
| InChI | InChI=1S/C11H14NO2.Li/c1-3-12(4-2)11(13)14-10-8-6-5-7-9-10;/h5-8H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | CAEZVHMUJNAWES-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium phenyl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium phenyl N,N-diethylcarbamate?
The IUPAC name of lithium phenyl N,N-diethylcarbamate (CID 25258917) is lithium phenyl N,N-diethylcarbamate.
What is the SMILES notation for lithium phenyl N,N-diethylcarbamate?
The canonical SMILES for lithium phenyl N,N-diethylcarbamate is CCN(CC)C(=O)Oc1[c-]cccc1.[Li+].
What is the InChIKey of lithium phenyl N,N-diethylcarbamate?
The InChIKey is CAEZVHMUJNAWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO2.Li/c1-3-12(4-2)11(13)14-10-8-6-5-7-9-10;/h5-8H,3-4H2,1-2H3;/q-1;+1.
What are the key properties of lithium phenyl N,N-diethylcarbamate?
lithium phenyl N,N-diethylcarbamate has a molecular weight of 199.18 g/mol, XLogP of -0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium phenyl N,N-diethylcarbamate is sourced from PubChem (CID 25258917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).