C23H31N3O — CID 25258922
3-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]phenol (PubChem CID 25258922) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is 3-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]phenol.
| Compound Name | 3-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]phenol |
|---|---|
| PubChem CID | 25258922 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 3-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-4-yl]phenol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cn1cc(-c2cccc(O)c2)nn1 |
| InChI | InChI=1S/C23H31N3O/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-26-17-23(24-25-26)21-12-7-13-22(27)16-21/h7-8,10,12-14,16-17,27H,5-6,9,11,15H2,1-4H3/b19-10+,20-14+ |
| InChIKey | HSJZKBKJKGJHPA-GNUCVDFRSA-N |
| XLogP | 6.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|