About 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole (PubChem CID 25258923) has the molecular formula C19H25N3O
and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole.
Molecular Properties
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole |
| PubChem CID | 25258923 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole |
| SMILES | COc1ccc(-c2cn(C/C=C(\C)CCC=C(C)C)nn2)cc1 |
| InChI | InChI=1S/C19H25N3O/c1-15(2)6-5-7-16(3)12-13-22-14-19(20-21-22)17-8-10-18(23-4)11-9-17/h6,8-12,14H,5,7,13H2,1-4H3/b16-12+ |
| InChIKey | MVMQTBKEDYWMNY-FOWTUZBSSA-N |
| XLogP | 4.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole?
The IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole (CID 25258923) is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole.
What is the SMILES notation for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole?
The canonical SMILES for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole is COc1ccc(-c2cn(C/C=C(\C)CCC=C(C)C)nn2)cc1.
What is the InChIKey of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole?
The InChIKey is MVMQTBKEDYWMNY-FOWTUZBSSA-N. The full InChI is InChI=1S/C19H25N3O/c1-15(2)6-5-7-16(3)12-13-22-14-19(20-21-22)17-8-10-18(23-4)11-9-17/h6,8-12,14H,5,7,13H2,1-4H3/b16-12+.
What are the key properties of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole?
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole has a molecular weight of 311.43 g/mol, XLogP of 4.65, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-(4-methoxyphenyl)triazole is sourced from PubChem (CID 25258923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).