About (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid
(4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 25259060) has the molecular formula C10H8FNO2S
and a molecular weight of 225.24 g/mol. Its IUPAC name is (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 25259060 |
| Molecular Formula | C10H8FNO2S |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(c2cccc(F)c2)=N1 |
| InChI | InChI=1S/C10H8FNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8H,5H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | MWWZADAZLWHISD-QMMMGPOBSA-N |
| XLogP | 1.77 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The IUPAC name of (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CID 25259060) is (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid is O=C(O)[C@@H]1CSC(c2cccc(F)c2)=N1.
What is the InChIKey of (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The InChIKey is MWWZADAZLWHISD-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H8FNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8H,5H2,(H,13,14)/t8-/m0/s1.
What are the key properties of (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
(4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid has a molecular weight of 225.24 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-(3-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 25259060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).