C25H17ClF7N7O — CID 25259165
2-N-[(6-chloro-3-pyridinyl)methyl]-6-N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 25259165) has the molecular formula C25H17ClF7N7O and a molecular weight of 599.90 g/mol. Its IUPAC name is 2-N-[(6-chloro-3-pyridinyl)methyl]-6-N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-[(6-chloro-3-pyridinyl)methyl]-6-N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 25259165 |
| Molecular Formula | C25H17ClF7N7O |
| Molecular Weight | 599.90 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | 2-N-[(6-chloro-3-pyridinyl)methyl]-6-N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | Fc1ccc(Nc2cc(N/N=C/c3ccc(OC(F)(F)F)cc3)nc(NCc3ccc(Cl)nc3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H17ClF7N7O/c26-20-8-3-15(11-34-20)12-35-23-38-21(37-16-4-7-19(27)18(9-16)24(28,29)30)10-22(39-23)40-36-13-14-1-5-17(6-2-14)41-25(31,32)33/h1-11,13H,12H2,(H3,35,37,38,39,40)/b36-13+ |
| InChIKey | UJSRQOABLLEPIU-FIFHTESVSA-N |
| XLogP | 7.38 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.90 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|