C21H14ClF8N5O2 — CID 25259388
6-chloro-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-N-[(E)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine (PubChem CID 25259388) has the molecular formula C21H14ClF8N5O2 and a molecular weight of 555.81 g/mol. Its IUPAC name is 6-chloro-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-N-[(E)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-N-[(E)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25259388 |
| Molecular Formula | C21H14ClF8N5O2 |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 6-chloro-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-N-[(E)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine |
| SMILES | FC(F)C(F)(F)Oc1ccc(Nc2cc(Cl)nc(N/N=C/c3cccc(OC(F)(F)C(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C21H14ClF8N5O2/c22-15-9-16(32-12-4-6-13(7-5-12)36-20(27,28)17(23)24)34-19(33-15)35-31-10-11-2-1-3-14(8-11)37-21(29,30)18(25)26/h1-10,17-18H,(H2,32,33,34,35)/b31-10+ |
| InChIKey | FPIFBRIBWZXXLI-VNTWQREPSA-N |
| XLogP | 6.79 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|