C20H12ClF8N5O — CID 25259389
6-chloro-2-N-[(E)-[4-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 25259389) has the molecular formula C20H12ClF8N5O and a molecular weight of 525.79 g/mol. Its IUPAC name is 6-chloro-2-N-[(E)-[4-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[(E)-[4-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25259389 |
| Molecular Formula | C20H12ClF8N5O |
| Molecular Weight | 525.79 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | 6-chloro-2-N-[(E)-[4-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | Fc1ccc(/C=N/Nc2nc(Cl)cc(Nc3ccc(OC(F)(F)C(F)F)cc3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H12ClF8N5O/c21-15-8-16(31-11-2-4-12(5-3-11)35-20(28,29)17(23)24)33-18(32-15)34-30-9-10-1-6-14(22)13(7-10)19(25,26)27/h1-9,17H,(H2,31,32,33,34)/b30-9+ |
| InChIKey | BMXJFLWREQNWRN-OOEWDAAOSA-N |
| XLogP | 6.71 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.79 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|