C27H40O7 — CID 25259398
decyl 2-[(6S)-2-acetyloxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate (PubChem CID 25259398) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is decyl 2-[(6S)-2-acetyloxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate.
| Compound Name | decyl 2-[(6S)-2-acetyloxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate |
|---|---|
| PubChem CID | 25259398 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | decyl 2-[(6S)-2-acetyloxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1CC(OC(C)=O)C[C@@]2(CCC3(C=CC(=O)C=C3)O2)O1 |
| InChI | InChI=1S/C27H40O7/c1-3-4-5-6-7-8-9-10-17-31-25(30)19-23-18-24(32-21(2)28)20-27(33-23)16-15-26(34-27)13-11-22(29)12-14-26/h11-14,23-24H,3-10,15-20H2,1-2H3/t23?,24?,27-/m0/s1 |
| InChIKey | PUGVOUXZHQZBJL-CXTIUDGFSA-N |
| XLogP | 5.11 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|