C19H13Cl2F4N5O — CID 25259616
6-chloro-2-N-[(E)-(4-chlorophenyl)methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 25259616) has the molecular formula C19H13Cl2F4N5O and a molecular weight of 474.25 g/mol. Its IUPAC name is 6-chloro-2-N-[(E)-(4-chlorophenyl)methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[(E)-(4-chlorophenyl)methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25259616 |
| Molecular Formula | C19H13Cl2F4N5O |
| Molecular Weight | 474.25 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 6-chloro-2-N-[(E)-(4-chlorophenyl)methylideneamino]-4-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | FC(F)C(F)(F)Oc1ccc(Nc2cc(Cl)nc(N/N=C/c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H13Cl2F4N5O/c20-12-3-1-11(2-4-12)10-26-30-18-28-15(21)9-16(29-18)27-13-5-7-14(8-6-13)31-19(24,25)17(22)23/h1-10,17H,(H2,27,28,29,30)/b26-10+ |
| InChIKey | LYBXVYWXWJRIIL-NSKAYECMSA-N |
| XLogP | 6.21 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.25 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|