C18H20Cl2N6O4 — CID 25259723
(2R,3R,4S,5R)-2-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol (PubChem CID 25259723) has the molecular formula C18H20Cl2N6O4 and a molecular weight of 455.30 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 25259723 |
| Molecular Formula | C18H20Cl2N6O4 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol |
| SMILES | COC[C@H]1O[C@@H](n2c(NCc3ccc(Cl)c(Cl)c3)nc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20Cl2N6O4/c1-29-6-11-13(27)14(28)17(30-11)26-16-12(15(21)23-7-24-16)25-18(26)22-5-8-2-3-9(19)10(20)4-8/h2-4,7,11,13-14,17,27-28H,5-6H2,1H3,(H,22,25)(H2,21,23,24)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | RYIGGQQHULYRSZ-LSCFUAHRSA-N |
| XLogP | 1.59 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |