About (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride
(2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride (PubChem CID 25259749) has the molecular formula C15H11ClN2OS
and a molecular weight of 302.79 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride |
| PubChem CID | 25259749 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccn1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H10N2OS.ClH/c18-14(12-8-4-5-9-16-12)13-10-19-15(17-13)11-6-2-1-3-7-11;/h1-10H;1H |
| InChIKey | KISMQULFSWOYOH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride?
The IUPAC name of (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride (CID 25259749) is (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride.
What is the SMILES notation for (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride?
The canonical SMILES for (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride is Cl.O=C(c1ccccn1)c1csc(-c2ccccc2)n1.
What is the InChIKey of (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride?
The InChIKey is KISMQULFSWOYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2OS.ClH/c18-14(12-8-4-5-9-16-12)13-10-19-15(17-13)11-6-2-1-3-7-11;/h1-10H;1H.
What are the key properties of (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride?
(2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride has a molecular weight of 302.79 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-4-yl)-pyridin-2-ylmethanone;hydrochloride is sourced from PubChem (CID 25259749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).