C24H23NO2 — CID 25260054
N-[2-[(4-methoxyphenoxy)methyl]prop-2-enyl]-1,1-diphenylmethanimine (PubChem CID 25260054) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenoxy)methyl]prop-2-enyl]-1,1-diphenylmethanimine.
| Compound Name | N-[2-[(4-methoxyphenoxy)methyl]prop-2-enyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 25260054 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[2-[(4-methoxyphenoxy)methyl]prop-2-enyl]-1,1-diphenylmethanimine |
| SMILES | C=C(CN=C(c1ccccc1)c1ccccc1)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H23NO2/c1-19(18-27-23-15-13-22(26-2)14-16-23)17-25-24(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16H,1,17-18H2,2H3 |
| InChIKey | PRQWBTMKSDOUFN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|