C28H26F3N7O4 — CID 25260173
(2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]oxolane-3,4-diol (PubChem CID 25260173) has the molecular formula C28H26F3N7O4 and a molecular weight of 581.56 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 25260173 |
| Molecular Formula | C28H26F3N7O4 |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(NCc1ccc3ncccc3c1)n2[C@@H]1O[C@H](COCc2ccc(C(F)(F)F)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H26F3N7O4/c29-28(30,31)18-6-3-15(4-7-18)12-41-13-20-22(39)23(40)26(42-20)38-25-21(24(32)35-14-36-25)37-27(38)34-11-16-5-8-19-17(10-16)2-1-9-33-19/h1-10,14,20,22-23,26,39-40H,11-13H2,(H,34,37)(H2,32,35,36)/t20-,22-,23-,26-/m1/s1 |
| InChIKey | AZIXNDKDTLENJY-HUBRGWSESA-N |
| XLogP | 3.42 |
| TPSA | 153.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |