C14H30O3Si — CID 25260361
(2S,3R)-2-[(2R,3S)-3-methyloxiran-2-yl]-3-triethylsilyloxypentan-2-ol (PubChem CID 25260361) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is (2S,3R)-2-[(2R,3S)-3-methyloxiran-2-yl]-3-triethylsilyloxypentan-2-ol.
| Compound Name | (2S,3R)-2-[(2R,3S)-3-methyloxiran-2-yl]-3-triethylsilyloxypentan-2-ol |
|---|---|
| PubChem CID | 25260361 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2S,3R)-2-[(2R,3S)-3-methyloxiran-2-yl]-3-triethylsilyloxypentan-2-ol |
| SMILES | CC[C@@H](O[Si](CC)(CC)CC)[C@@](C)(O)[C@@H]1O[C@H]1C |
| InChI | InChI=1S/C14H30O3Si/c1-7-12(14(6,15)13-11(5)16-13)17-18(8-2,9-3)10-4/h11-13,15H,7-10H2,1-6H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | FGMVGBMYZGKUML-REWJHTLYSA-N |
| XLogP | 3.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|