C21H21FIN7O5S — CID 25260680
[1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]pyrrolidin-3-yl] sulfamate (PubChem CID 25260680) has the molecular formula C21H21FIN7O5S and a molecular weight of 629.41 g/mol. Its IUPAC name is [1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]pyrrolidin-3-yl] sulfamate.
| Compound Name | [1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]pyrrolidin-3-yl] sulfamate |
|---|---|
| PubChem CID | 25260680 |
| Molecular Formula | C21H21FIN7O5S |
| Molecular Weight | 629.41 g/mol |
| Exact Mass | 629.04 |
| IUPAC Name | [1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]pyrrolidin-3-yl] sulfamate |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CC#CCN1CCC(OS(N)(=O)=O)C1 |
| InChI | InChI=1S/C21H21FIN7O5S/c22-21-27-19(24)18-20(28-21)30(5-2-1-4-29-6-3-13(10-29)35-36(25,31)32)17(26-18)8-12-7-15-16(9-14(12)23)34-11-33-15/h7,9,13H,3-6,8,10-11H2,(H2,24,27,28)(H2,25,31,32) |
| InChIKey | CWLKDMZNRGTYMK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|