C22H19Cl2N5O4 — CID 25260753
2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N,3,5-trimethoxybenzamide (PubChem CID 25260753) has the molecular formula C22H19Cl2N5O4 and a molecular weight of 488.33 g/mol. Its IUPAC name is 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N,3,5-trimethoxybenzamide.
| Compound Name | 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N,3,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 25260753 |
| Molecular Formula | C22H19Cl2N5O4 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N,3,5-trimethoxybenzamide |
| SMILES | CONC(=O)c1cc(OC)cc(OC)c1-c1nc2ncccn2c1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H19Cl2N5O4/c1-31-12-10-13(21(30)28-33-3)17(16(11-12)32-2)19-20(29-9-5-8-25-22(29)27-19)26-18-14(23)6-4-7-15(18)24/h4-11,26H,1-3H3,(H,28,30) |
| InChIKey | LBNJDDSDSPLYMF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|