C28H28N4O2 — CID 25260881
5-[4-[(1R,2R)-2-[4-[(2-aminophenyl)methoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 25260881) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 5-[4-[(1R,2R)-2-[4-[(2-aminophenyl)methoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[4-[(1R,2R)-2-[4-[(2-aminophenyl)methoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 25260881 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 5-[4-[(1R,2R)-2-[4-[(2-aminophenyl)methoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc([C@@]3(c4ccc(OCc5ccccc5N)cc4)CC4CC[C@@H]3C4)cc2)o1 |
| InChI | InChI=1S/C28H28N4O2/c29-25-4-2-1-3-20(25)17-33-24-13-11-22(12-14-24)28(16-18-5-8-23(28)15-18)21-9-6-19(7-10-21)26-31-32-27(30)34-26/h1-4,6-7,9-14,18,23H,5,8,15-17,29H2,(H2,30,32)/t18?,23-,28-/m1/s1 |
| InChIKey | CMICQBSEGVTBTP-MUPDOLTESA-N |
| XLogP | 5.59 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|