C30H33N9O3S — CID 25260893
4-[5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 25260893) has the molecular formula C30H33N9O3S and a molecular weight of 599.72 g/mol. Its IUPAC name is 4-[5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 25260893 |
| Molecular Formula | C30H33N9O3S |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 4-[5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-N-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | COc1nc(OC)nc(N2CCc3sc(-c4nc(Nc5ccc(OCCN6CCCC6)cc5)nc5[nH]ccc45)cc3C2)n1 |
| InChI | InChI=1S/C30H33N9O3S/c1-40-29-35-28(36-30(37-29)41-2)39-14-10-23-19(18-39)17-24(43-23)25-22-9-11-31-26(22)34-27(33-25)32-20-5-7-21(8-6-20)42-16-15-38-12-3-4-13-38/h5-9,11,17H,3-4,10,12-16,18H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | QLTMQZFOEXSOHE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 126.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |