C32H31FN4O — CID 25261102
3-[2-(4-fluorophenyl)-4-pyridinyl]-7-[3-(3-piperidin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine (PubChem CID 25261102) has the molecular formula C32H31FN4O and a molecular weight of 506.63 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-4-pyridinyl]-7-[3-(3-piperidin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 3-[2-(4-fluorophenyl)-4-pyridinyl]-7-[3-(3-piperidin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 25261102 |
| Molecular Formula | C32H31FN4O |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-4-pyridinyl]-7-[3-(3-piperidin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine |
| SMILES | Fc1ccc(-c2cc(-c3cnc4cc(-c5cccc(OCCCN6CCCCC6)c5)ccn34)ccn2)cc1 |
| InChI | InChI=1S/C32H31FN4O/c33-28-10-8-24(9-11-28)30-21-27(12-14-34-30)31-23-35-32-22-26(13-18-37(31)32)25-6-4-7-29(20-25)38-19-5-17-36-15-2-1-3-16-36/h4,6-14,18,20-23H,1-3,5,15-17,19H2 |
| InChIKey | KYAILCUUOVDDJA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|