C16H19NO7 — CID 25261216
2-[(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-carbonyl)amino]acetic acid (PubChem CID 25261216) has the molecular formula C16H19NO7 and a molecular weight of 337.33 g/mol. Its IUPAC name is 2-[(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-carbonyl)amino]acetic acid.
| Compound Name | 2-[(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 25261216 |
| Molecular Formula | C16H19NO7 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[(4-hydroxy-6-oxospiro[1,3-dioxine-2,2'-adamantane]-5-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)OC2(OC1=O)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C16H19NO7/c18-11(19)6-17-13(20)12-14(21)23-16(24-15(12)22)9-2-7-1-8(4-9)5-10(16)3-7/h7-10,21H,1-6H2,(H,17,20)(H,18,19) |
| InChIKey | UYGMAMRACJQELE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|