C15H17F9O3Si — CID 25261331
trimethoxy-[2-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]ethyl]silane (PubChem CID 25261331) has the molecular formula C15H17F9O3Si and a molecular weight of 444.37 g/mol. Its IUPAC name is trimethoxy-[2-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]ethyl]silane.
| Compound Name | trimethoxy-[2-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]ethyl]silane |
|---|---|
| PubChem CID | 25261331 |
| Molecular Formula | C15H17F9O3Si |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | trimethoxy-[2-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]ethyl]silane |
| SMILES | CO[Si](CCc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)(OC)OC |
| InChI | InChI=1S/C15H17F9O3Si/c1-25-28(26-2,27-3)9-8-10-4-6-11(7-5-10)12(16,17)13(18,19)14(20,21)15(22,23)24/h4-7H,8-9H2,1-3H3 |
| InChIKey | NAGKNIBWZMOEHO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|