ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate

C31H28N2O2 — CID 25261861

IUPACethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate
SMILESCCOC(=O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1
InChIInChI=1S/C31H28N2O2/c1-2-35-30(34)31(27-21-13-6-14-22-27)28(25-17-9-4-10-18-25)33(23-24-15-7-3-8-16-24)29(32-31)26-19-11-5-12-20-26/h3-22,28H,2,23H2,1H3
InChIKeyPVUSNWSCRYFKFI-UHFFFAOYSA-N
MW460.58 g/mol
LogP6.15
Rot. Bonds7

About ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate

ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (PubChem CID 25261861) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.

Molecular Properties

Compound Nameethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate
PubChem CID25261861
Molecular FormulaC31H28N2O2
Molecular Weight460.58 g/mol
Exact Mass460.22
IUPAC Nameethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate
SMILESCCOC(=O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1
InChIInChI=1S/C31H28N2O2/c1-2-35-30(34)31(27-21-13-6-14-22-27)28(25-17-9-4-10-18-25)33(23-24-15-7-3-8-16-24)29(32-31)26-19-11-5-12-20-26/h3-22,28H,2,23H2,1H3
InChIKeyPVUSNWSCRYFKFI-UHFFFAOYSA-N
XLogP6.15
TPSA41.90 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms35
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500460.58
LogP ≤ 56.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate?
The IUPAC name of ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (CID 25261861) is ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.
What is the SMILES notation for ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate?
The canonical SMILES for ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate is CCOC(=O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1.
What is the InChIKey of ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate?
The InChIKey is PVUSNWSCRYFKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28N2O2/c1-2-35-30(34)31(27-21-13-6-14-22-27)28(25-17-9-4-10-18-25)33(23-24-15-7-3-8-16-24)29(32-31)26-19-11-5-12-20-26/h3-22,28H,2,23H2,1H3.
What are the key properties of ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate?
ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate has a molecular weight of 460.58 g/mol, XLogP of 6.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate is sourced from PubChem (CID 25261861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).