About (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate
(3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate (PubChem CID 25262002) has the molecular formula C33H32N2O4
and a molecular weight of 520.63 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate |
| PubChem CID | 25262002 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate |
| SMILES | COc1ccc(COC(=O)C2(C)N=C(c3ccccc3)N(Cc3ccccc3)C2c2ccccc2)cc1OC |
| InChI | InChI=1S/C33H32N2O4/c1-33(32(36)39-23-25-19-20-28(37-2)29(21-25)38-3)30(26-15-9-5-10-16-26)35(22-24-13-7-4-8-14-24)31(34-33)27-17-11-6-12-18-27/h4-21,30H,22-23H2,1-3H3 |
| InChIKey | BCDSHISABTZFHS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The IUPAC name of (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate (CID 25262002) is (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate.
What is the SMILES notation for (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The canonical SMILES for (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate is COc1ccc(COC(=O)C2(C)N=C(c3ccccc3)N(Cc3ccccc3)C2c2ccccc2)cc1OC.
What is the InChIKey of (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The InChIKey is BCDSHISABTZFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H32N2O4/c1-33(32(36)39-23-25-19-20-28(37-2)29(21-25)38-3)30(26-15-9-5-10-16-26)35(22-24-13-7-4-8-14-24)31(34-33)27-17-11-6-12-18-27/h4-21,30H,22-23H2,1-3H3.
What are the key properties of (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
(3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate has a molecular weight of 520.63 g/mol, XLogP of 6.21, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate is sourced from PubChem (CID 25262002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).