About (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate
(4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate (PubChem CID 25262150) has the molecular formula C32H30N2O3
and a molecular weight of 490.60 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate |
| PubChem CID | 25262150 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate |
| SMILES | COc1ccc(COC(=O)C2(C)N=C(c3ccccc3)N(Cc3ccccc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N2O3/c1-32(31(35)37-23-25-18-20-28(36-2)21-19-25)29(26-14-8-4-9-15-26)34(22-24-12-6-3-7-13-24)30(33-32)27-16-10-5-11-17-27/h3-21,29H,22-23H2,1-2H3 |
| InChIKey | UZPJEKNTAYTVQC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The IUPAC name of (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate (CID 25262150) is (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate.
What is the SMILES notation for (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The canonical SMILES for (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate is COc1ccc(COC(=O)C2(C)N=C(c3ccccc3)N(Cc3ccccc3)C2c2ccccc2)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The InChIKey is UZPJEKNTAYTVQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H30N2O3/c1-32(31(35)37-23-25-18-20-28(36-2)21-19-25)29(26-14-8-4-9-15-26)34(22-24-12-6-3-7-13-24)30(33-32)27-16-10-5-11-17-27/h3-21,29H,22-23H2,1-2H3.
What are the key properties of (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
(4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate has a molecular weight of 490.60 g/mol, XLogP of 6.20, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate is sourced from PubChem (CID 25262150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).