About (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate
(3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate (PubChem CID 25262151) has the molecular formula C31H26Cl2N2O2
and a molecular weight of 529.47 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate |
| PubChem CID | 25262151 |
| Molecular Formula | C31H26Cl2N2O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate |
| SMILES | CC1(C(=O)OCc2ccc(Cl)c(Cl)c2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C31H26Cl2N2O2/c1-31(30(36)37-21-23-17-18-26(32)27(33)19-23)28(24-13-7-3-8-14-24)35(20-22-11-5-2-6-12-22)29(34-31)25-15-9-4-10-16-25/h2-19,28H,20-21H2,1H3 |
| InChIKey | FWRQDBPHFHZKRJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The IUPAC name of (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate (CID 25262151) is (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate.
What is the SMILES notation for (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The canonical SMILES for (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate is CC1(C(=O)OCc2ccc(Cl)c(Cl)c2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1.
What is the InChIKey of (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
The InChIKey is FWRQDBPHFHZKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26Cl2N2O2/c1-31(30(36)37-21-23-17-18-26(32)27(33)19-23)28(24-13-7-3-8-14-24)35(20-22-11-5-2-6-12-22)29(34-31)25-15-9-4-10-16-25/h2-19,28H,20-21H2,1H3.
What are the key properties of (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate?
(3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate has a molecular weight of 529.47 g/mol, XLogP of 7.50, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)methyl 3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylate is sourced from PubChem (CID 25262151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).