C22H27N7O2 — CID 25262477
5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]pyridin-2-amine (PubChem CID 25262477) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]pyridin-2-amine.
| Compound Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 25262477 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]pyridin-2-amine |
| SMILES | C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2ccc(-c3ccc(N)nc3)nc2n1 |
| InChI | InChI=1S/C22H27N7O2/c1-14-12-30-9-7-28(14)21-17-4-5-18(16-3-6-19(23)24-11-16)25-20(17)26-22(27-21)29-8-10-31-13-15(29)2/h3-6,11,14-15H,7-10,12-13H2,1-2H3,(H2,23,24)/t14-,15-/m0/s1 |
| InChIKey | HGFHLLYMDRBZPO-GJZGRUSLSA-N |
| XLogP | 2.12 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |