C20H25FIN7O5S — CID 25262864
2-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]ethyl sulfamate (PubChem CID 25262864) has the molecular formula C20H25FIN7O5S and a molecular weight of 621.43 g/mol. Its IUPAC name is 2-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]ethyl sulfamate.
| Compound Name | 2-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]ethyl sulfamate |
|---|---|
| PubChem CID | 25262864 |
| Molecular Formula | C20H25FIN7O5S |
| Molecular Weight | 621.43 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | 2-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethyl-propan-2-ylamino]ethyl sulfamate |
| SMILES | CC(C)N(CCOS(N)(=O)=O)CCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C20H25FIN7O5S/c1-11(2)28(5-6-34-35(24,30)31)3-4-29-16(25-17-18(23)26-20(21)27-19(17)29)8-12-7-14-15(9-13(12)22)33-10-32-14/h7,9,11H,3-6,8,10H2,1-2H3,(H2,23,26,27)(H2,24,30,31) |
| InChIKey | CWSHKZXCCALQIP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|