C22H23FIN7O5S — CID 25263032
[1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-yl] sulfamate (PubChem CID 25263032) has the molecular formula C22H23FIN7O5S and a molecular weight of 643.44 g/mol. Its IUPAC name is [1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-yl] sulfamate.
| Compound Name | [1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-yl] sulfamate |
|---|---|
| PubChem CID | 25263032 |
| Molecular Formula | C22H23FIN7O5S |
| Molecular Weight | 643.44 g/mol |
| Exact Mass | 643.05 |
| IUPAC Name | [1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-yl] sulfamate |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CC#CCN1CCC(OS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C22H23FIN7O5S/c23-22-28-20(25)19-21(29-22)31(6-2-1-5-30-7-3-14(4-8-30)36-37(26,32)33)18(27-19)10-13-9-16-17(11-15(13)24)35-12-34-16/h9,11,14H,3-8,10,12H2,(H2,25,28,29)(H2,26,32,33) |
| InChIKey | YICZDPVMXYLVDG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|