C20H28O5 — CID 25263060
4-[(Z)-but-2-enyl]-3,5,6-trihydroxy-2-(3-methylbutanoyl)-6-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one (PubChem CID 25263060) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 4-[(Z)-but-2-enyl]-3,5,6-trihydroxy-2-(3-methylbutanoyl)-6-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 4-[(Z)-but-2-enyl]-3,5,6-trihydroxy-2-(3-methylbutanoyl)-6-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 25263060 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 4-[(Z)-but-2-enyl]-3,5,6-trihydroxy-2-(3-methylbutanoyl)-6-(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
| SMILES | C/C=C\CC1=C(O)C(O)(CC=C(C)C)C(=O)C(C(=O)CC(C)C)=C1O |
| InChI | InChI=1S/C20H28O5/c1-6-7-8-14-17(22)16(15(21)11-13(4)5)19(24)20(25,18(14)23)10-9-12(2)3/h6-7,9,13,22-23,25H,8,10-11H2,1-5H3/b7-6- |
| InChIKey | XTNBSBJBFXSZKL-SREVYHEPSA-N |
| XLogP | 3.86 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|