C22H18F3N3O3S2 — CID 25263113
5-(5,6-dimethoxybenzimidazol-1-yl)-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carbothioamide (PubChem CID 25263113) has the molecular formula C22H18F3N3O3S2 and a molecular weight of 493.53 g/mol. Its IUPAC name is 5-(5,6-dimethoxybenzimidazol-1-yl)-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carbothioamide.
| Compound Name | 5-(5,6-dimethoxybenzimidazol-1-yl)-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 25263113 |
| Molecular Formula | C22H18F3N3O3S2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 5-(5,6-dimethoxybenzimidazol-1-yl)-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carbothioamide |
| SMILES | COc1cc2ncn(-c3cc(OCc4ccccc4C(F)(F)F)c(C(N)=S)s3)c2cc1OC |
| InChI | InChI=1S/C22H18F3N3O3S2/c1-29-16-7-14-15(8-17(16)30-2)28(11-27-14)19-9-18(20(33-19)21(26)32)31-10-12-5-3-4-6-13(12)22(23,24)25/h3-9,11H,10H2,1-2H3,(H2,26,32) |
| InChIKey | ILMBJKKVPWRVCZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|