About (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide
(E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide (PubChem CID 25263224) has the molecular formula C19H23N5O
and a molecular weight of 337.43 g/mol. Its IUPAC name is (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide |
| PubChem CID | 25263224 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide |
| SMILES | CN1CCCN(c2cncc(-c3cccc(/C=C/C(N)=O)c3)n2)CC1 |
| InChI | InChI=1S/C19H23N5O/c1-23-8-3-9-24(11-10-23)19-14-21-13-17(22-19)16-5-2-4-15(12-16)6-7-18(20)25/h2,4-7,12-14H,3,8-11H2,1H3,(H2,20,25)/b7-6+ |
| InChIKey | QQYNGYCPUGWHFT-VOTSOKGWSA-N |
| XLogP | 1.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide?
The IUPAC name of (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide (CID 25263224) is (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide.
What is the SMILES notation for (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide?
The canonical SMILES for (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide is CN1CCCN(c2cncc(-c3cccc(/C=C/C(N)=O)c3)n2)CC1.
What is the InChIKey of (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide?
The InChIKey is QQYNGYCPUGWHFT-VOTSOKGWSA-N. The full InChI is InChI=1S/C19H23N5O/c1-23-8-3-9-24(11-10-23)19-14-21-13-17(22-19)16-5-2-4-15(12-16)6-7-18(20)25/h2,4-7,12-14H,3,8-11H2,1H3,(H2,20,25)/b7-6+.
What are the key properties of (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide?
(E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide has a molecular weight of 337.43 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enamide is sourced from PubChem (CID 25263224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).