C16H16N6 — CID 25263283
N,5,12-trimethyl-4-phenyl-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 25263283) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is N,5,12-trimethyl-4-phenyl-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | N,5,12-trimethyl-4-phenyl-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 25263283 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N,5,12-trimethyl-4-phenyl-3,5,7,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CNc1nc2c(nc(-c3ccccc3)n2C)c2c1ncn2C |
| InChI | InChI=1S/C16H16N6/c1-17-14-11-13(21(2)9-18-11)12-16(20-14)22(3)15(19-12)10-7-5-4-6-8-10/h4-9H,1-3H3,(H,17,20) |
| InChIKey | FUTLJNOGKQFKCL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |