C16H16N6S — CID 25263285
4-N-benzyl-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine (PubChem CID 25263285) has the molecular formula C16H16N6S and a molecular weight of 324.41 g/mol. Its IUPAC name is 4-N-benzyl-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine.
| Compound Name | 4-N-benzyl-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine |
|---|---|
| PubChem CID | 25263285 |
| Molecular Formula | C16H16N6S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-N-benzyl-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine |
| SMILES | CNc1nc2sc(NCc3ccccc3)nc2c2c1ncn2C |
| InChI | InChI=1S/C16H16N6S/c1-17-14-11-13(22(2)9-19-11)12-15(21-14)23-16(20-12)18-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | XFIVFKDLJZTDDV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |