C11H12N6OS — CID 25263288
N,12-dimethyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4-carboxamide (PubChem CID 25263288) has the molecular formula C11H12N6OS and a molecular weight of 276.33 g/mol. Its IUPAC name is N,12-dimethyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4-carboxamide.
| Compound Name | N,12-dimethyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 25263288 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N,12-dimethyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4-carboxamide |
| SMILES | CNC(=O)c1nc2c(nc(NC)c3ncn(C)c32)s1 |
| InChI | InChI=1S/C11H12N6OS/c1-12-8-5-7(17(3)4-14-5)6-10(16-8)19-11(15-6)9(18)13-2/h4H,1-3H3,(H,12,16)(H,13,18) |
| InChIKey | BYMRVDVGQVMXFP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |