C18H19FN6OS — CID 25263293
2-[2-[[4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-yl]amino]ethylamino]ethanol (PubChem CID 25263293) has the molecular formula C18H19FN6OS and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[2-[[4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-yl]amino]ethylamino]ethanol.
| Compound Name | 2-[2-[[4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-yl]amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 25263293 |
| Molecular Formula | C18H19FN6OS |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-[2-[[4-(4-fluorophenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-yl]amino]ethylamino]ethanol |
| SMILES | Cn1cnc2c(NCCNCCO)nc3sc(-c4ccc(F)cc4)nc3c21 |
| InChI | InChI=1S/C18H19FN6OS/c1-25-10-22-13-15(25)14-18(24-16(13)21-7-6-20-8-9-26)27-17(23-14)11-2-4-12(19)5-3-11/h2-5,10,20,26H,6-9H2,1H3,(H,21,24) |
| InChIKey | KMSKRTSNTUEYNV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|