C18H20F2N2O — CID 25263308
1-[3-[(3,4-difluorophenyl)methoxy]-2-methylphenyl]piperazine (PubChem CID 25263308) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[3-[(3,4-difluorophenyl)methoxy]-2-methylphenyl]piperazine.
| Compound Name | 1-[3-[(3,4-difluorophenyl)methoxy]-2-methylphenyl]piperazine |
|---|---|
| PubChem CID | 25263308 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[3-[(3,4-difluorophenyl)methoxy]-2-methylphenyl]piperazine |
| SMILES | Cc1c(OCc2ccc(F)c(F)c2)cccc1N1CCNCC1 |
| InChI | InChI=1S/C18H20F2N2O/c1-13-17(22-9-7-21-8-10-22)3-2-4-18(13)23-12-14-5-6-15(19)16(20)11-14/h2-6,11,21H,7-10,12H2,1H3 |
| InChIKey | PAFUAENTYHACBL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |