About 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide
4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide (PubChem CID 25263444) has the molecular formula C13H18N2O3S
and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide |
| PubChem CID | 25263444 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide |
| SMILES | CC[C@H](C)[C@@H](CO)NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-3-10(2)13(9-16)15-19(17,18)12-6-4-11(8-14)5-7-12/h4-7,10,13,15-16H,3,9H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | YZUXEUMOSYLXGH-GXFFZTMASA-N |
| XLogP | 1.24 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide?
The IUPAC name of 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide (CID 25263444) is 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide.
What is the SMILES notation for 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide?
The canonical SMILES for 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide is CC[C@H](C)[C@@H](CO)NS(=O)(=O)c1ccc(C#N)cc1.
What is the InChIKey of 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide?
The InChIKey is YZUXEUMOSYLXGH-GXFFZTMASA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-3-10(2)13(9-16)15-19(17,18)12-6-4-11(8-14)5-7-12/h4-7,10,13,15-16H,3,9H2,1-2H3/t10-,13+/m0/s1.
What are the key properties of 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide?
4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide has a molecular weight of 282.37 g/mol, XLogP of 1.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]benzenesulfonamide is sourced from PubChem (CID 25263444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).