About N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide
N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide (PubChem CID 25263449) has the molecular formula C12H18N2O5S
and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide |
| PubChem CID | 25263449 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide |
| SMILES | CC[C@H](C)[C@@H](CO)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N2O5S/c1-3-9(2)12(8-15)13-20(18,19)11-6-4-10(5-7-11)14(16)17/h4-7,9,12-13,15H,3,8H2,1-2H3/t9-,12+/m0/s1 |
| InChIKey | NSMRBMXKKMVINK-JOYOIKCWSA-N |
| XLogP | 1.28 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide?
The IUPAC name of N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide (CID 25263449) is N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide.
What is the SMILES notation for N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide?
The canonical SMILES for N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide is CC[C@H](C)[C@@H](CO)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide?
The InChIKey is NSMRBMXKKMVINK-JOYOIKCWSA-N. The full InChI is InChI=1S/C12H18N2O5S/c1-3-9(2)12(8-15)13-20(18,19)11-6-4-10(5-7-11)14(16)17/h4-7,9,12-13,15H,3,8H2,1-2H3/t9-,12+/m0/s1.
What are the key properties of N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide?
N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide has a molecular weight of 302.35 g/mol, XLogP of 1.28, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-nitrobenzenesulfonamide is sourced from PubChem (CID 25263449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).