About 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole
2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole (PubChem CID 25263516) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole |
| PubChem CID | 25263516 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole |
| SMILES | CN1C(=C=C2N(C)c3ccccc3N2C)N(C)c2ccccc21 |
| InChI | InChI=1S/C19H20N4/c1-20-14-9-5-6-10-15(14)21(2)18(20)13-19-22(3)16-11-7-8-12-17(16)23(19)4/h5-12H,1-4H3 |
| InChIKey | CRLGEIHRXIQKOI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole?
The IUPAC name of 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole (CID 25263516) is 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole.
What is the SMILES notation for 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole?
The canonical SMILES for 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole is CN1C(=C=C2N(C)c3ccccc3N2C)N(C)c2ccccc21.
What is the InChIKey of 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole?
The InChIKey is CRLGEIHRXIQKOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4/c1-20-14-9-5-6-10-15(14)21(2)18(20)13-19-22(3)16-11-7-8-12-17(16)23(19)4/h5-12H,1-4H3.
What are the key properties of 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole?
2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole has a molecular weight of 304.40 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethylbenzimidazol-2-ylidene)methylidene]-1,3-dimethylbenzimidazole is sourced from PubChem (CID 25263516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).