C27H33FN8O2 — CID 25263994
(9aR)-8-[[9-ethyl-2-(5-fluoro-1H-indol-4-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 25263994) has the molecular formula C27H33FN8O2 and a molecular weight of 520.61 g/mol. Its IUPAC name is (9aR)-8-[[9-ethyl-2-(5-fluoro-1H-indol-4-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aR)-8-[[9-ethyl-2-(5-fluoro-1H-indol-4-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 25263994 |
| Molecular Formula | C27H33FN8O2 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (9aR)-8-[[9-ethyl-2-(5-fluoro-1H-indol-4-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | CCn1c(CN2CCN3CCOC[C@H]3C2)nc2c(N3CCOCC3)nc(-c3c(F)ccc4[nH]ccc34)nc21 |
| InChI | InChI=1S/C27H33FN8O2/c1-2-36-22(16-33-7-8-34-9-14-38-17-18(34)15-33)30-24-26(35-10-12-37-13-11-35)31-25(32-27(24)36)23-19-5-6-29-21(19)4-3-20(23)28/h3-6,18,29H,2,7-17H2,1H3/t18-/m1/s1 |
| InChIKey | NNOHGTUVEJTUBB-GOSISDBHSA-N |
| XLogP | 2.49 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |