About [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate
[4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate (PubChem CID 25264033) has the molecular formula C20H19NO10
and a molecular weight of 433.37 g/mol. Its IUPAC name is [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate |
| PubChem CID | 25264033 |
| Molecular Formula | C20H19NO10 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCOC(=O)c1ccc(OCCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19NO10/c1-14(22)31-18-6-3-2-5-17(18)20(24)29-13-28-19(23)15-7-9-16(10-8-15)27-11-4-12-30-21(25)26/h2-3,5-10H,4,11-13H2,1H3 |
| InChIKey | UYAKJNDMYSQUAR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 140.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate?
The IUPAC name of [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate (CID 25264033) is [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate.
What is the SMILES notation for [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate?
The canonical SMILES for [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OCOC(=O)c1ccc(OCCCO[N+](=O)[O-])cc1.
What is the InChIKey of [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate?
The InChIKey is UYAKJNDMYSQUAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO10/c1-14(22)31-18-6-3-2-5-17(18)20(24)29-13-28-19(23)15-7-9-16(10-8-15)27-11-4-12-30-21(25)26/h2-3,5-10H,4,11-13H2,1H3.
What are the key properties of [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate?
[4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate has a molecular weight of 433.37 g/mol, XLogP of 2.56, 11 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-nitrooxypropoxy)benzoyl]oxymethyl 2-acetyloxybenzoate is sourced from PubChem (CID 25264033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).